About 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one
7-tert-butylsulfanyl-4,4-dimethylheptan-3-one (PubChem CID 88908641) has the molecular formula C13H26OS
and a molecular weight of 230.42 g/mol. Its IUPAC name is 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one.
Molecular Properties
| Compound Name | 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one |
| PubChem CID | 88908641 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one |
| SMILES | CCC(=O)C(C)(C)CCCSC(C)(C)C |
| InChI | InChI=1S/C13H26OS/c1-7-11(14)13(5,6)9-8-10-15-12(2,3)4/h7-10H2,1-6H3 |
| InChIKey | AWXYHAAUFNYUAU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one?
The IUPAC name of 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one (CID 88908641) is 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one.
What is the SMILES notation for 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one?
The canonical SMILES for 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one is CCC(=O)C(C)(C)CCCSC(C)(C)C.
What is the InChIKey of 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one?
The InChIKey is AWXYHAAUFNYUAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OS/c1-7-11(14)13(5,6)9-8-10-15-12(2,3)4/h7-10H2,1-6H3.
What are the key properties of 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one?
7-tert-butylsulfanyl-4,4-dimethylheptan-3-one has a molecular weight of 230.42 g/mol, XLogP of 4.30, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butylsulfanyl-4,4-dimethylheptan-3-one is sourced from PubChem (CID 88908641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).