C10H16O6 — CID 88908738
(2R)-2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetic acid (PubChem CID 88908738) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is (2R)-2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetic acid.
| Compound Name | (2R)-2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetic acid |
|---|---|
| PubChem CID | 88908738 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | (2R)-2-[(4R,6S)-6-formyl-2,2-dimethyl-1,3-dioxan-4-yl]-2-methoxyacetic acid |
| SMILES | CO[C@@H](C(=O)O)[C@H]1C[C@@H](C=O)OC(C)(C)O1 |
| InChI | InChI=1S/C10H16O6/c1-10(2)15-6(5-11)4-7(16-10)8(14-3)9(12)13/h5-8H,4H2,1-3H3,(H,12,13)/t6-,7+,8+/m0/s1 |
| InChIKey | XEMQAINZGLNASR-XLPZGREQSA-N |
| XLogP | 0.20 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|