C14H24N2 — CID 88909240
1-ethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]piperazine (PubChem CID 88909240) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-ethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]piperazine.
| Compound Name | 1-ethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]piperazine |
|---|---|
| PubChem CID | 88909240 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-ethyl-4-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]piperazine |
| SMILES | C=C/C(C)=C\C=C(/C)N1CCN(CC)CC1 |
| InChI | InChI=1S/C14H24N2/c1-5-13(3)7-8-14(4)16-11-9-15(6-2)10-12-16/h5,7-8H,1,6,9-12H2,2-4H3/b13-7-,14-8+ |
| InChIKey | BWYFKBFWVZOHMS-MFUUIURDSA-N |
| XLogP | 2.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|