C25H21F5N2O2 — CID 88910277
2-[2-[2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol (PubChem CID 88910277) has the molecular formula C25H21F5N2O2 and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-[2-[2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol.
| Compound Name | 2-[2-[2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 88910277 |
| Molecular Formula | C25H21F5N2O2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-[2-[2-[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]-3H-benzimidazol-5-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccccc1-c1ccc2nc(-c3ccc(OCC(F)(F)C(F)(F)F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H21F5N2O2/c1-23(2,33)19-6-4-3-5-18(19)16-9-12-20-21(13-16)32-22(31-20)15-7-10-17(11-8-15)34-14-24(26,27)25(28,29)30/h3-13,33H,14H2,1-2H3,(H,31,32) |
| InChIKey | MFADJNVSWORSBM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|