C20H21F2IO2S2 — CID 88910345
5-[3-[(1R,2R,3R,5R)-2-[(3,5-difluorophenyl)sulfanylmethyl]-3-hydroxy-5-iodocyclopentyl]propyl]thiophene-2-carbaldehyde (PubChem CID 88910345) has the molecular formula C20H21F2IO2S2 and a molecular weight of 522.42 g/mol. Its IUPAC name is 5-[3-[(1R,2R,3R,5R)-2-[(3,5-difluorophenyl)sulfanylmethyl]-3-hydroxy-5-iodocyclopentyl]propyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-[(1R,2R,3R,5R)-2-[(3,5-difluorophenyl)sulfanylmethyl]-3-hydroxy-5-iodocyclopentyl]propyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 88910345 |
| Molecular Formula | C20H21F2IO2S2 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | 5-[3-[(1R,2R,3R,5R)-2-[(3,5-difluorophenyl)sulfanylmethyl]-3-hydroxy-5-iodocyclopentyl]propyl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(CCC[C@@H]2[C@@H](CSc3cc(F)cc(F)c3)[C@H](O)C[C@H]2I)s1 |
| InChI | InChI=1S/C20H21F2IO2S2/c21-12-6-13(22)8-16(7-12)26-11-18-17(19(23)9-20(18)25)3-1-2-14-4-5-15(10-24)27-14/h4-8,10,17-20,25H,1-3,9,11H2/t17-,18-,19-,20-/m1/s1 |
| InChIKey | CLGPHCXQYIMMAI-UAFMIMERSA-N |
| XLogP | 5.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|