C9H7F11O4 — CID 88910432
1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2,3,3,3-pentafluoropropoxy)ethyl carbonate (PubChem CID 88910432) has the molecular formula C9H7F11O4 and a molecular weight of 388.13 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2,3,3,3-pentafluoropropoxy)ethyl carbonate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2,3,3,3-pentafluoropropoxy)ethyl carbonate |
|---|---|
| PubChem CID | 88910432 |
| Molecular Formula | C9H7F11O4 |
| Molecular Weight | 388.13 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-(2,2,3,3,3-pentafluoropropoxy)ethyl carbonate |
| SMILES | O=C(OCCOCC(F)(F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H7F11O4/c10-6(11,9(18,19)20)3-22-1-2-23-5(21)24-4(7(12,13)14)8(15,16)17/h4H,1-3H2 |
| InChIKey | ZHWLBJPOKDUZRO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|