About [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate
[2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate (PubChem CID 88910714) has the molecular formula C23H15N3O3S
and a molecular weight of 413.46 g/mol. Its IUPAC name is [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate.
Molecular Properties
| Compound Name | [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate |
| PubChem CID | 88910714 |
| Molecular Formula | C23H15N3O3S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate |
| SMILES | O=COc1csc(-n2nc(-c3ccc(Oc4ccccc4)cc3)c3ccccc32)n1 |
| InChI | InChI=1S/C23H15N3O3S/c27-15-28-21-14-30-23(24-21)26-20-9-5-4-8-19(20)22(25-26)16-10-12-18(13-11-16)29-17-6-2-1-3-7-17/h1-15H |
| InChIKey | HNODRCKZTSRXPB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate?
The IUPAC name of [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate (CID 88910714) is [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate.
What is the SMILES notation for [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate?
The canonical SMILES for [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate is O=COc1csc(-n2nc(-c3ccc(Oc4ccccc4)cc3)c3ccccc32)n1.
What is the InChIKey of [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate?
The InChIKey is HNODRCKZTSRXPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N3O3S/c27-15-28-21-14-30-23(24-21)26-20-9-5-4-8-19(20)22(25-26)16-10-12-18(13-11-16)29-17-6-2-1-3-7-17/h1-15H.
What are the key properties of [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate?
[2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate has a molecular weight of 413.46 g/mol, XLogP of 5.48, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[3-(4-phenoxyphenyl)indazol-1-yl]-1,3-thiazol-4-yl] formate is sourced from PubChem (CID 88910714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).