About [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate
[2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate (PubChem CID 88910732) has the molecular formula C19H16N4O2S
and a molecular weight of 364.43 g/mol. Its IUPAC name is [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate.
Molecular Properties
| Compound Name | [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate |
| PubChem CID | 88910732 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate |
| SMILES | CN(C)c1ccc(-c2nn(-c3nc(OC=O)cs3)c3ccccc23)cc1 |
| InChI | InChI=1S/C19H16N4O2S/c1-22(2)14-9-7-13(8-10-14)18-15-5-3-4-6-16(15)23(21-18)19-20-17(11-26-19)25-12-24/h3-12H,1-2H3 |
| InChIKey | RHYLRSHQWFGNOZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate?
The IUPAC name of [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate (CID 88910732) is [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate.
What is the SMILES notation for [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate?
The canonical SMILES for [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate is CN(C)c1ccc(-c2nn(-c3nc(OC=O)cs3)c3ccccc23)cc1.
What is the InChIKey of [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate?
The InChIKey is RHYLRSHQWFGNOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2S/c1-22(2)14-9-7-13(8-10-14)18-15-5-3-4-6-16(15)23(21-18)19-20-17(11-26-19)25-12-24/h3-12H,1-2H3.
What are the key properties of [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate?
[2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate has a molecular weight of 364.43 g/mol, XLogP of 3.75, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[3-[4-(dimethylamino)phenyl]indazol-1-yl]-1,3-thiazol-4-yl] formate is sourced from PubChem (CID 88910732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).