C21H19N3O3S — CID 88910767
[2-[6-(2-methylpropoxy)-3-phenylindazol-1-yl]-1,3-thiazol-4-yl] formate (PubChem CID 88910767) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is [2-[6-(2-methylpropoxy)-3-phenylindazol-1-yl]-1,3-thiazol-4-yl] formate.
| Compound Name | [2-[6-(2-methylpropoxy)-3-phenylindazol-1-yl]-1,3-thiazol-4-yl] formate |
|---|---|
| PubChem CID | 88910767 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [2-[6-(2-methylpropoxy)-3-phenylindazol-1-yl]-1,3-thiazol-4-yl] formate |
| SMILES | CC(C)COc1ccc2c(-c3ccccc3)nn(-c3nc(OC=O)cs3)c2c1 |
| InChI | InChI=1S/C21H19N3O3S/c1-14(2)11-26-16-8-9-17-18(10-16)24(21-22-19(12-28-21)27-13-25)23-20(17)15-6-4-3-5-7-15/h3-10,12-14H,11H2,1-2H3 |
| InChIKey | QIAPSVBXWILIIN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|