C26H36BNO3 — CID 88910919
N-but-3-ynyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetamide (PubChem CID 88910919) has the molecular formula C26H36BNO3 and a molecular weight of 421.39 g/mol. Its IUPAC name is N-but-3-ynyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetamide.
| Compound Name | N-but-3-ynyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetamide |
|---|---|
| PubChem CID | 88910919 |
| Molecular Formula | C26H36BNO3 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-but-3-ynyl-2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[1,2-dihydroindene-3,4'-cyclohexane]-1'-yl]acetamide |
| SMILES | C#CCCNC(=O)CC1CCC2(CCc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)CC1 |
| InChI | InChI=1S/C26H36BNO3/c1-6-7-16-28-23(29)17-19-10-13-26(14-11-19)15-12-20-18-21(8-9-22(20)26)27-30-24(2,3)25(4,5)31-27/h1,8-9,18-19H,7,10-17H2,2-5H3,(H,28,29) |
| InChIKey | UQEKHPTVRNWBCC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|