About 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene
5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene (PubChem CID 88911089) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene |
| PubChem CID | 88911089 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene |
| SMILES | COCOc1cc2c(cc1N=O)CCC2 |
| InChI | InChI=1S/C11H13NO3/c1-14-7-15-11-6-9-4-2-3-8(9)5-10(11)12-13/h5-6H,2-4,7H2,1H3 |
| InChIKey | NSASWAHSFNOVQV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene?
The IUPAC name of 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene (CID 88911089) is 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene.
What is the SMILES notation for 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene?
The canonical SMILES for 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene is COCOc1cc2c(cc1N=O)CCC2.
What is the InChIKey of 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene?
The InChIKey is NSASWAHSFNOVQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-14-7-15-11-6-9-4-2-3-8(9)5-10(11)12-13/h5-6H,2-4,7H2,1H3.
What are the key properties of 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene?
5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene has a molecular weight of 207.23 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethoxy)-6-nitroso-2,3-dihydro-1H-indene is sourced from PubChem (CID 88911089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).