C31H36FN7OS — CID 88911208
5-[2-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-ethyl-4-(3-methoxy-5-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 88911208) has the molecular formula C31H36FN7OS and a molecular weight of 573.74 g/mol. Its IUPAC name is 5-[2-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-ethyl-4-(3-methoxy-5-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-[2-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-ethyl-4-(3-methoxy-5-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 88911208 |
| Molecular Formula | C31H36FN7OS |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | 5-[2-[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-3-fluoroanilino]pyrimidin-4-yl]-N-ethyl-4-(3-methoxy-5-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | CCNc1nc(-c2cc(C)cc(OC)c2)c(-c2ccnc(Nc3ccc(N4CCN5CCCCC5C4)c(F)c3)n2)s1 |
| InChI | InChI=1S/C31H36FN7OS/c1-4-33-31-37-28(21-15-20(2)16-24(17-21)40-3)29(41-31)26-10-11-34-30(36-26)35-22-8-9-27(25(32)18-22)39-14-13-38-12-6-5-7-23(38)19-39/h8-11,15-18,23H,4-7,12-14,19H2,1-3H3,(H,33,37)(H,34,35,36) |
| InChIKey | LOPKJJROXJTDTL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|