C15H26N3O3+ — CID 88911242
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-(3-methylimidazol-3-ium-1-yl)acetate (PubChem CID 88911242) has the molecular formula C15H26N3O3+ and a molecular weight of 296.39 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-(3-methylimidazol-3-ium-1-yl)acetate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-(3-methylimidazol-3-ium-1-yl)acetate |
|---|---|
| PubChem CID | 88911242 |
| Molecular Formula | C15H26N3O3+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-(3-methylimidazol-3-ium-1-yl)acetate |
| SMILES | C[n+]1ccn(CC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)c1 |
| InChI | InChI=1S/C15H26N3O3/c1-14(2)8-12(9-15(3,4)18(14)20)21-13(19)10-17-7-6-16(5)11-17/h6-7,11-12,20H,8-10H2,1-5H3/q+1 |
| InChIKey | XOIYZLVVJNYPIS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|