C20H15F6N3O — CID 88911428
8-[2,4-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)-5,6-dihydronaphthalene-2-carboxamide (PubChem CID 88911428) has the molecular formula C20H15F6N3O and a molecular weight of 427.35 g/mol. Its IUPAC name is 8-[2,4-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)-5,6-dihydronaphthalene-2-carboxamide.
| Compound Name | 8-[2,4-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)-5,6-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 88911428 |
| Molecular Formula | C20H15F6N3O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 8-[2,4-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)-5,6-dihydronaphthalene-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2c(c1)C(c1ccc(C(F)(F)F)cc1C(F)(F)F)=CCC2 |
| InChI | InChI=1S/C20H15F6N3O/c21-19(22,23)12-6-7-14(16(9-12)20(24,25)26)13-3-1-2-10-4-5-11(8-15(10)13)17(30)29-18(27)28/h3-9H,1-2H2,(H4,27,28,29,30) |
| InChIKey | JVJMWLIENSCUQE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|