C30H32N2O5 — CID 88911673
(4-formylphenyl) 4-[[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylamino]benzoate (PubChem CID 88911673) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is (4-formylphenyl) 4-[[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylamino]benzoate.
| Compound Name | (4-formylphenyl) 4-[[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylamino]benzoate |
|---|---|
| PubChem CID | 88911673 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (4-formylphenyl) 4-[[3-(3-ethyl-1-methylazepan-3-yl)phenoxy]carbonylamino]benzoate |
| SMILES | CCC1(c2cccc(OC(=O)Nc3ccc(C(=O)Oc4ccc(C=O)cc4)cc3)c2)CCCCN(C)C1 |
| InChI | InChI=1S/C30H32N2O5/c1-3-30(17-4-5-18-32(2)21-30)24-7-6-8-27(19-24)37-29(35)31-25-13-11-23(12-14-25)28(34)36-26-15-9-22(20-33)10-16-26/h6-16,19-20H,3-5,17-18,21H2,1-2H3,(H,31,35) |
| InChIKey | LHWIVPGADOTNGV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|