C8H4F6S — CID 88911679
4,4,5,5,6,6-hexafluoro-3-methylcyclopenta[c]thiophene (PubChem CID 88911679) has the molecular formula C8H4F6S and a molecular weight of 246.17 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexafluoro-3-methylcyclopenta[c]thiophene.
| Compound Name | 4,4,5,5,6,6-hexafluoro-3-methylcyclopenta[c]thiophene |
|---|---|
| PubChem CID | 88911679 |
| Molecular Formula | C8H4F6S |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 4,4,5,5,6,6-hexafluoro-3-methylcyclopenta[c]thiophene |
| SMILES | Cc1scc2c1C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C8H4F6S/c1-3-5-4(2-15-3)6(9,10)8(13,14)7(5,11)12/h2H,1H3 |
| InChIKey | UMHMNRCLYFPSAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|