C32H57F2NO2SSi2 — CID 88912197
[[[(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1-difluorobutyl]-oxo-phenyl-λ6-sulfanylidene]amino]-tert-butyl-dimethylsilane (PubChem CID 88912197) has the molecular formula C32H57F2NO2SSi2 and a molecular weight of 614.05 g/mol. Its IUPAC name is [[[(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1-difluorobutyl]-oxo-phenyl-λ6-sulfanylidene]amino]-tert-butyl-dimethylsilane.
| Compound Name | [[[(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1-difluorobutyl]-oxo-phenyl-λ6-sulfanylidene]amino]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 88912197 |
| Molecular Formula | C32H57F2NO2SSi2 |
| Molecular Weight | 614.05 g/mol |
| Exact Mass | 613.36 |
| IUPAC Name | [[[(3R)-3-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1-difluorobutyl]-oxo-phenyl-λ6-sulfanylidene]amino]-tert-butyl-dimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)[C@@H]([C@H](C)CC(F)(F)S(=O)(=N[Si](C)(C)C(C)(C)C)c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C32H57F2NO2SSi2/c1-11-40(12-2,13-3)37-29-20-17-23-31(8)27(21-22-28(29)31)25(4)24-32(33,34)38(36,26-18-15-14-16-19-26)35-39(9,10)30(5,6)7/h14-16,18-19,25,27-29H,11-13,17,20-24H2,1-10H3/t25-,27-,28+,29+,31-,38?/m1/s1 |
| InChIKey | LVWPXVUNQJMXHK-ITCUJNEESA-N |
| XLogP | 10.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.05 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|