About 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde
6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde (PubChem CID 88912357) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde.
Molecular Properties
| Compound Name | 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde |
| PubChem CID | 88912357 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde |
| SMILES | COC1C=C=CC=C1C=O |
| InChI | InChI=1S/C8H8O2/c1-10-8-5-3-2-4-7(8)6-9/h2,4-6,8H,1H3 |
| InChIKey | PUURHNYIJQUJAC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde?
The IUPAC name of 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde (CID 88912357) is 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde.
What is the SMILES notation for 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde?
The canonical SMILES for 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde is COC1C=C=CC=C1C=O.
What is the InChIKey of 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde?
The InChIKey is PUURHNYIJQUJAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2/c1-10-8-5-3-2-4-7(8)6-9/h2,4-6,8H,1H3.
What are the key properties of 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde?
6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde has a molecular weight of 136.15 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxycyclohexa-1,3,4-triene-1-carbaldehyde is sourced from PubChem (CID 88912357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).