C10H18OS — CID 88912397
(2E,6E)-2,6-dimethyl-8-sulfanylocta-2,6-dien-1-ol (PubChem CID 88912397) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethyl-8-sulfanylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-2,6-dimethyl-8-sulfanylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 88912397 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (2E,6E)-2,6-dimethyl-8-sulfanylocta-2,6-dien-1-ol |
| SMILES | C/C(=C\CC/C(C)=C/CS)CO |
| InChI | InChI=1S/C10H18OS/c1-9(6-7-12)4-3-5-10(2)8-11/h5-6,11-12H,3-4,7-8H2,1-2H3/b9-6+,10-5+ |
| InChIKey | GILCJLALCOLJBK-TXFIJWAUSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|