C12H15N3OS3 — CID 8891253
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N,N-diethylcarbamodithioate (PubChem CID 8891253) has the molecular formula C12H15N3OS3 and a molecular weight of 313.47 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N,N-diethylcarbamodithioate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8891253 |
| Molecular Formula | C12H15N3OS3 |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C12H15N3OS3/c1-3-14(4-2)12(17)19-8-9-7-10(16)15-5-6-18-11(15)13-9/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | RGZSBORLQYUSQN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|