About N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide
N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide (PubChem CID 88912660) has the molecular formula C19H37N5O4
and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide.
Molecular Properties
| Compound Name | N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide |
| PubChem CID | 88912660 |
| Molecular Formula | C19H37N5O4 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide |
| SMILES | CC(=O)CCCC(=O)NC(CNC(C)(C)/C(C)=N/O)CNC(C)(C)/C(C)=N/O |
| InChI | InChI=1S/C19H37N5O4/c1-13(25)9-8-10-17(26)22-16(11-20-18(4,5)14(2)23-27)12-21-19(6,7)15(3)24-28/h16,20-21,27-28H,8-12H2,1-7H3,(H,22,26)/b23-14+,24-15+ |
| InChIKey | LKSVZBRXTKKUBT-OZEVPFDHSA-N |
| XLogP | 1.67 |
| TPSA | 135.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide?
The IUPAC name of N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide (CID 88912660) is N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide.
What is the SMILES notation for N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide?
The canonical SMILES for N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide is CC(=O)CCCC(=O)NC(CNC(C)(C)/C(C)=N/O)CNC(C)(C)/C(C)=N/O.
What is the InChIKey of N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide?
The InChIKey is LKSVZBRXTKKUBT-OZEVPFDHSA-N. The full InChI is InChI=1S/C19H37N5O4/c1-13(25)9-8-10-17(26)22-16(11-20-18(4,5)14(2)23-27)12-21-19(6,7)15(3)24-28/h16,20-21,27-28H,8-12H2,1-7H3,(H,22,26)/b23-14+,24-15+.
What are the key properties of N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide?
N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide has a molecular weight of 399.54 g/mol, XLogP of 1.67, 13 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1,3-bis[[(3E)-3-hydroxyimino-2-methylbutan-2-yl]amino]propan-2-yl]-5-oxohexanamide is sourced from PubChem (CID 88912660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).