C20H16N2O2 — CID 88912869
2-[(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-3-one (PubChem CID 88912869) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-3-one.
| Compound Name | 2-[(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-3-one |
|---|---|
| PubChem CID | 88912869 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-3-one |
| SMILES | CC1=NOC(CN2C(=O)c3ccccc3C#Cc3ccccc32)C1 |
| InChI | InChI=1S/C20H16N2O2/c1-14-12-17(24-21-14)13-22-19-9-5-3-7-16(19)11-10-15-6-2-4-8-18(15)20(22)23/h2-9,17H,12-13H2,1H3 |
| InChIKey | PTUDTXMSONWDHB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|