C18H28FN3O2 — CID 88913034
5-fluoro-N-methoxy-1,3-dimethyl-N-[1-(2,2,4-trimethylcyclohex-3-en-1-yl)ethyl]pyrazole-4-carboxamide (PubChem CID 88913034) has the molecular formula C18H28FN3O2 and a molecular weight of 337.44 g/mol. Its IUPAC name is 5-fluoro-N-methoxy-1,3-dimethyl-N-[1-(2,2,4-trimethylcyclohex-3-en-1-yl)ethyl]pyrazole-4-carboxamide.
| Compound Name | 5-fluoro-N-methoxy-1,3-dimethyl-N-[1-(2,2,4-trimethylcyclohex-3-en-1-yl)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 88913034 |
| Molecular Formula | C18H28FN3O2 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 5-fluoro-N-methoxy-1,3-dimethyl-N-[1-(2,2,4-trimethylcyclohex-3-en-1-yl)ethyl]pyrazole-4-carboxamide |
| SMILES | CON(C(=O)c1c(C)nn(C)c1F)C(C)C1CCC(C)=CC1(C)C |
| InChI | InChI=1S/C18H28FN3O2/c1-11-8-9-14(18(4,5)10-11)13(3)22(24-7)17(23)15-12(2)20-21(6)16(15)19/h10,13-14H,8-9H2,1-7H3 |
| InChIKey | VEKSGHROEKRZSG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|