C19H23NO2 — CID 889131
(2S)-2-(3,5-dimethylphenoxy)-N-(2,4-dimethylphenyl)propanamide (PubChem CID 889131) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethylphenoxy)-N-(2,4-dimethylphenyl)propanamide.
| Compound Name | (2S)-2-(3,5-dimethylphenoxy)-N-(2,4-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 889131 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2S)-2-(3,5-dimethylphenoxy)-N-(2,4-dimethylphenyl)propanamide |
| SMILES | Cc1cc(C)cc(O[C@@H](C)C(=O)Nc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C19H23NO2/c1-12-6-7-18(15(4)9-12)20-19(21)16(5)22-17-10-13(2)8-14(3)11-17/h6-11,16H,1-5H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | BCEPJTMIOKDGEJ-INIZCTEOSA-N |
| XLogP | 4.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |