About CID 88913114
CID 88913114 (PubChem CID 88913114) has the molecular formula C6H3B2IN4
and a molecular weight of 279.65 g/mol.
Molecular Properties
| Compound Name | CID 88913114 |
| PubChem CID | 88913114 |
| Molecular Formula | C6H3B2IN4 |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | — |
| SMILES | [B]NN([B])c1nccc(I)c1C#N |
| InChI | InChI=1S/C6H3B2IN4/c7-12-13(8)6-4(3-10)5(9)1-2-11-6/h1-2,12H |
| InChIKey | HLBFAJWYUREHHA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 88913114 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88913114?
The IUPAC name of CID 88913114 (CID 88913114) is not available.
What is the SMILES notation for CID 88913114?
The canonical SMILES for CID 88913114 is [B]NN([B])c1nccc(I)c1C#N.
What is the InChIKey of CID 88913114?
The InChIKey is HLBFAJWYUREHHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3B2IN4/c7-12-13(8)6-4(3-10)5(9)1-2-11-6/h1-2,12H.
What are the key properties of CID 88913114?
CID 88913114 has a molecular weight of 279.65 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88913114 is sourced from PubChem (CID 88913114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).