C32H14F8O14S4 — CID 88913267
4-[4-[4-(3,6-disulfonaphthalen-1-yl)oxy-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]naphthalene-2,7-disulfonic acid (PubChem CID 88913267) has the molecular formula C32H14F8O14S4 and a molecular weight of 902.70 g/mol. Its IUPAC name is 4-[4-[4-(3,6-disulfonaphthalen-1-yl)oxy-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]naphthalene-2,7-disulfonic acid.
| Compound Name | 4-[4-[4-(3,6-disulfonaphthalen-1-yl)oxy-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]naphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 88913267 |
| Molecular Formula | C32H14F8O14S4 |
| Molecular Weight | 902.70 g/mol |
| Exact Mass | 901.91 |
| IUPAC Name | 4-[4-[4-(3,6-disulfonaphthalen-1-yl)oxy-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]naphthalene-2,7-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(Oc3c(F)c(F)c(-c4c(F)c(F)c(Oc5cc(S(=O)(=O)O)cc6cc(S(=O)(=O)O)ccc56)c(F)c4F)c(F)c3F)cc(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/C32H14F8O14S4/c33-23-21(24(34)28(38)31(27(23)37)53-19-9-15(57(47,48)49)7-11-5-13(55(41,42)43)1-3-17(11)19)22-25(35)29(39)32(30(40)26(22)36)54-20-10-16(58(50,51)52)8-12-6-14(56(44,45)46)2-4-18(12)20/h1-10H,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H,50,51,52) |
| InChIKey | JLZFEGXWBXAFIQ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 235.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.70 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|