C27H33F4N — CID 88913474
2-[4-[(2E,4E)-3,5-difluoro-4-(fluoromethyl)hepta-2,4,6-trienyl]-3-fluorocyclohex-2-en-1-yl]-5-(4-ethenylcyclohexyl)-2,3-dihydropyridine (PubChem CID 88913474) has the molecular formula C27H33F4N and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-[4-[(2E,4E)-3,5-difluoro-4-(fluoromethyl)hepta-2,4,6-trienyl]-3-fluorocyclohex-2-en-1-yl]-5-(4-ethenylcyclohexyl)-2,3-dihydropyridine.
| Compound Name | 2-[4-[(2E,4E)-3,5-difluoro-4-(fluoromethyl)hepta-2,4,6-trienyl]-3-fluorocyclohex-2-en-1-yl]-5-(4-ethenylcyclohexyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 88913474 |
| Molecular Formula | C27H33F4N |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 2-[4-[(2E,4E)-3,5-difluoro-4-(fluoromethyl)hepta-2,4,6-trienyl]-3-fluorocyclohex-2-en-1-yl]-5-(4-ethenylcyclohexyl)-2,3-dihydropyridine |
| SMILES | C=C/C(F)=C(CF)\C(F)=C/CC1CCC(C2CC=C(C3CCC(C=C)CC3)C=N2)C=C1F |
| InChI | InChI=1S/C27H33F4N/c1-3-18-5-7-19(8-6-18)22-12-14-27(32-17-22)21-10-9-20(26(31)15-21)11-13-25(30)23(16-28)24(29)4-2/h3-4,12-13,15,17-21,27H,1-2,5-11,14,16H2/b24-23+,25-13+ |
| InChIKey | FFWTTXUEWXMIQC-ZGSYIBEGSA-N |
| XLogP | 8.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|