About CpODA
CpODA (PubChem CID 88913496) has the molecular formula C21H20O7
and a molecular weight of 384.38 g/mol.
Molecular Properties
| Compound Name | CpODA |
| PubChem CID | 88913496 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | — |
| SMILES | O=C1OC(=O)C2C1C1CC2C2(CCC3(CC4CC3C3C(=O)OC(=O)C43)C2=O)C1 |
| InChI | InChI=1S/C21H20O7/c22-15-11-7-3-9(13(11)17(24)27-15)20(5-7)1-2-21(19(20)26)6-8-4-10(21)14-12(8)16(23)28-18(14)25/h7-14H,1-6H2 |
| InChIKey | OVASAEXSPYGGES-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CpODA with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CpODA?
The IUPAC name of CpODA (CID 88913496) is not available.
What is the SMILES notation for CpODA?
The canonical SMILES for CpODA is O=C1OC(=O)C2C1C1CC2C2(CCC3(CC4CC3C3C(=O)OC(=O)C43)C2=O)C1.
What is the InChIKey of CpODA?
The InChIKey is OVASAEXSPYGGES-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20O7/c22-15-11-7-3-9(13(11)17(24)27-15)20(5-7)1-2-21(19(20)26)6-8-4-10(21)14-12(8)16(23)28-18(14)25/h7-14H,1-6H2.
What are the key properties of CpODA?
CpODA has a molecular weight of 384.38 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CpODA is sourced from PubChem (CID 88913496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).