About 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone
1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone (PubChem CID 88913624) has the molecular formula C7H8ClNO
and a molecular weight of 157.60 g/mol. Its IUPAC name is 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone.
Molecular Properties
| Compound Name | 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone |
| PubChem CID | 88913624 |
| Molecular Formula | C7H8ClNO |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone |
| SMILES | NC1C=CC(C(=O)CCl)=C1 |
| InChI | InChI=1S/C7H8ClNO/c8-4-7(10)5-1-2-6(9)3-5/h1-3,6H,4,9H2 |
| InChIKey | GWJPZSJXVXONJH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone?
The IUPAC name of 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone (CID 88913624) is 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone.
What is the SMILES notation for 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone?
The canonical SMILES for 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone is NC1C=CC(C(=O)CCl)=C1.
What is the InChIKey of 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone?
The InChIKey is GWJPZSJXVXONJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO/c8-4-7(10)5-1-2-6(9)3-5/h1-3,6H,4,9H2.
What are the key properties of 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone?
1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone has a molecular weight of 157.60 g/mol, XLogP of 0.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminocyclopenta-1,4-dien-1-yl)-2-chloroethanone is sourced from PubChem (CID 88913624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).