C20H14F4O6S2 — CID 88914084
1,2,4,5-tetrafluoro-3,6-bis[(4-methoxyphenyl)sulfonyl]benzene (PubChem CID 88914084) has the molecular formula C20H14F4O6S2 and a molecular weight of 490.45 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3,6-bis[(4-methoxyphenyl)sulfonyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3,6-bis[(4-methoxyphenyl)sulfonyl]benzene |
|---|---|
| PubChem CID | 88914084 |
| Molecular Formula | C20H14F4O6S2 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3,6-bis[(4-methoxyphenyl)sulfonyl]benzene |
| SMILES | COc1ccc(S(=O)(=O)c2c(F)c(F)c(S(=O)(=O)c3ccc(OC)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C20H14F4O6S2/c1-29-11-3-7-13(8-4-11)31(25,26)19-15(21)17(23)20(18(24)16(19)22)32(27,28)14-9-5-12(30-2)6-10-14/h3-10H,1-2H3 |
| InChIKey | IHSPXEPNSDBLHL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|