About 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide
2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide (PubChem CID 88914151) has the molecular formula C15H31NOS
and a molecular weight of 273.49 g/mol. Its IUPAC name is 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide.
Molecular Properties
| Compound Name | 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide |
| PubChem CID | 88914151 |
| Molecular Formula | C15H31NOS |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide |
| SMILES | CC(C)(C)CC(C(=O)NC(C)(C)CS)C(C)(C)C |
| InChI | InChI=1S/C15H31NOS/c1-13(2,3)9-11(14(4,5)6)12(17)16-15(7,8)10-18/h11,18H,9-10H2,1-8H3,(H,16,17) |
| InChIKey | TUGVXZBICFUULH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide?
The IUPAC name of 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide (CID 88914151) is 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide.
What is the SMILES notation for 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide?
The canonical SMILES for 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide is CC(C)(C)CC(C(=O)NC(C)(C)CS)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide?
The InChIKey is TUGVXZBICFUULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NOS/c1-13(2,3)9-11(14(4,5)6)12(17)16-15(7,8)10-18/h11,18H,9-10H2,1-8H3,(H,16,17).
What are the key properties of 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide?
2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide has a molecular weight of 273.49 g/mol, XLogP of 3.91, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,4-dimethyl-N-(2-methyl-1-sulfanylpropan-2-yl)pentanamide is sourced from PubChem (CID 88914151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).