C14H2F6N2 — CID 88914315
4-(4-cyano-2,5-difluorophenyl)-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 88914315) has the molecular formula C14H2F6N2 and a molecular weight of 312.17 g/mol. Its IUPAC name is 4-(4-cyano-2,5-difluorophenyl)-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-(4-cyano-2,5-difluorophenyl)-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 88914315 |
| Molecular Formula | C14H2F6N2 |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 4-(4-cyano-2,5-difluorophenyl)-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(-c2c(F)c(F)c(C#N)c(F)c2F)cc1F |
| InChI | InChI=1S/C14H2F6N2/c15-8-2-6(9(16)1-5(8)3-21)10-13(19)11(17)7(4-22)12(18)14(10)20/h1-2H |
| InChIKey | YTYXLSHXEUWMLS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|