About N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine
N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 88914323) has the molecular formula C6H14Cl2N2
and a molecular weight of 185.10 g/mol. Its IUPAC name is N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 88914323 |
| Molecular Formula | C6H14Cl2N2 |
| Molecular Weight | 185.10 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCl)CCN(C)CCl |
| InChI | InChI=1S/C6H14Cl2N2/c1-9(5-7)3-4-10(2)6-8/h3-6H2,1-2H3 |
| InChIKey | PMLPBQPAXMIZCZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.10 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine (CID 88914323) is N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine is CN(CCl)CCN(C)CCl.
What is the InChIKey of N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine?
The InChIKey is PMLPBQPAXMIZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14Cl2N2/c1-9(5-7)3-4-10(2)6-8/h3-6H2,1-2H3.
What are the key properties of N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine?
N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine has a molecular weight of 185.10 g/mol, XLogP of 1.24, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(chloromethyl)-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 88914323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).