C24H38N8O2 — CID 88914541
4-N-[(3Z)-4-cyclopropyl-4-hydrazinylbuta-1,3-dien-2-yl]-6-[2-(diethylamino)ethoxy]-2-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pyrimidine-2,4-diamine (PubChem CID 88914541) has the molecular formula C24H38N8O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 4-N-[(3Z)-4-cyclopropyl-4-hydrazinylbuta-1,3-dien-2-yl]-6-[2-(diethylamino)ethoxy]-2-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[(3Z)-4-cyclopropyl-4-hydrazinylbuta-1,3-dien-2-yl]-6-[2-(diethylamino)ethoxy]-2-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 88914541 |
| Molecular Formula | C24H38N8O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | 4-N-[(3Z)-4-cyclopropyl-4-hydrazinylbuta-1,3-dien-2-yl]-6-[2-(diethylamino)ethoxy]-2-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]pyrimidine-2,4-diamine |
| SMILES | C=C(/C=C(\NN)C1CC1)Nc1cc(OCCN(CC)CC)nc(NCc2cc(C(C)C)no2)n1 |
| InChI | InChI=1S/C24H38N8O2/c1-6-32(7-2)10-11-33-23-14-22(27-17(5)12-21(30-25)18-8-9-18)28-24(29-23)26-15-19-13-20(16(3)4)31-34-19/h12-14,16,18,30H,5-11,15,25H2,1-4H3,(H2,26,27,28,29)/b21-12- |
| InChIKey | VGHGHBLPRJUOLV-MTJSOVHGSA-N |
| XLogP | 3.60 |
| TPSA | 126.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|