C7H8ClNOS — CID 88914682
5-chloro-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one (PubChem CID 88914682) has the molecular formula C7H8ClNOS and a molecular weight of 189.67 g/mol. Its IUPAC name is 5-chloro-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one.
| Compound Name | 5-chloro-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 88914682 |
| Molecular Formula | C7H8ClNOS |
| Molecular Weight | 189.67 g/mol |
| Exact Mass | 189.00 |
| IUPAC Name | 5-chloro-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-2-one |
| SMILES | O=C1C=C2CN(Cl)CCC2S1 |
| InChI | InChI=1S/C7H8ClNOS/c8-9-2-1-6-5(4-9)3-7(10)11-6/h3,6H,1-2,4H2 |
| InChIKey | RCXPKPJYQXGJOL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.67 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|