C9H18N2 — CID 88914723
N-buta-1,3-dien-2-yl-N',N'-dimethylpropane-1,3-diamine (PubChem CID 88914723) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-buta-1,3-dien-2-yl-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 88914723 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N-buta-1,3-dien-2-yl-N',N'-dimethylpropane-1,3-diamine |
| SMILES | C=CC(=C)NCCCN(C)C |
| InChI | InChI=1S/C9H18N2/c1-5-9(2)10-7-6-8-11(3)4/h5,10H,1-2,6-8H2,3-4H3 |
| InChIKey | CXDFEJXGMQLSMH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|