C9H16N2 — CID 88914835
(Z,3E)-N',N'-dimethyl-3-prop-2-enylidenebut-1-ene-1,4-diamine (PubChem CID 88914835) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (Z,3E)-N',N'-dimethyl-3-prop-2-enylidenebut-1-ene-1,4-diamine.
| Compound Name | (Z,3E)-N',N'-dimethyl-3-prop-2-enylidenebut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 88914835 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (Z,3E)-N',N'-dimethyl-3-prop-2-enylidenebut-1-ene-1,4-diamine |
| SMILES | C=C/C=C(\C=C/N)CN(C)C |
| InChI | InChI=1S/C9H16N2/c1-4-5-9(6-7-10)8-11(2)3/h4-7H,1,8,10H2,2-3H3/b7-6-,9-5+ |
| InChIKey | KCPADJASZNZVNA-QRLJIZSYSA-N |
| XLogP | 1.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|