C10H17NO3S — CID 88914839
(3Z,6Z)-8-amino-5-methylnona-1,3,6-triene-5-sulfonic acid (PubChem CID 88914839) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is (3Z,6Z)-8-amino-5-methylnona-1,3,6-triene-5-sulfonic acid.
| Compound Name | (3Z,6Z)-8-amino-5-methylnona-1,3,6-triene-5-sulfonic acid |
|---|---|
| PubChem CID | 88914839 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (3Z,6Z)-8-amino-5-methylnona-1,3,6-triene-5-sulfonic acid |
| SMILES | C=C/C=C\C(C)(/C=C\C(C)N)S(=O)(=O)O |
| InChI | InChI=1S/C10H17NO3S/c1-4-5-7-10(3,15(12,13)14)8-6-9(2)11/h4-9H,1,11H2,2-3H3,(H,12,13,14)/b7-5-,8-6- |
| InChIKey | TXZMJBFLTXSYBA-SFECMWDFSA-N |
| XLogP | 1.28 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|