About 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine
2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine (PubChem CID 88915026) has the molecular formula C11H11ClN2O
and a molecular weight of 222.68 g/mol. Its IUPAC name is 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine |
| PubChem CID | 88915026 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine |
| SMILES | COC1C=CC(c2cnc(Cl)nc2)=CC1 |
| InChI | InChI=1S/C11H11ClN2O/c1-15-10-4-2-8(3-5-10)9-6-13-11(12)14-7-9/h2-4,6-7,10H,5H2,1H3 |
| InChIKey | OVZPCXDYFJDWAH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine?
The IUPAC name of 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine (CID 88915026) is 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine.
What is the SMILES notation for 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine?
The canonical SMILES for 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine is COC1C=CC(c2cnc(Cl)nc2)=CC1.
What is the InChIKey of 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine?
The InChIKey is OVZPCXDYFJDWAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O/c1-15-10-4-2-8(3-5-10)9-6-13-11(12)14-7-9/h2-4,6-7,10H,5H2,1H3.
What are the key properties of 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine?
2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine has a molecular weight of 222.68 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(4-methoxycyclohexa-1,5-dien-1-yl)pyrimidine is sourced from PubChem (CID 88915026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).