C19H34O5Si — CID 88915103
7,7-dimethyl-5-propa-1,2-dienyl-2-(2-trimethylsilylethoxy)-2,3,4,4a,5,6,9,9a-octahydropyrano[2,3-c]oxepine-3,4-diol (PubChem CID 88915103) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is 7,7-dimethyl-5-propa-1,2-dienyl-2-(2-trimethylsilylethoxy)-2,3,4,4a,5,6,9,9a-octahydropyrano[2,3-c]oxepine-3,4-diol.
| Compound Name | 7,7-dimethyl-5-propa-1,2-dienyl-2-(2-trimethylsilylethoxy)-2,3,4,4a,5,6,9,9a-octahydropyrano[2,3-c]oxepine-3,4-diol |
|---|---|
| PubChem CID | 88915103 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 7,7-dimethyl-5-propa-1,2-dienyl-2-(2-trimethylsilylethoxy)-2,3,4,4a,5,6,9,9a-octahydropyrano[2,3-c]oxepine-3,4-diol |
| SMILES | C=C=CC1CC(C)(C)OCC2OC(OCC[Si](C)(C)C)C(O)C(O)C12 |
| InChI | InChI=1S/C19H34O5Si/c1-7-8-13-11-19(2,3)23-12-14-15(13)16(20)17(21)18(24-14)22-9-10-25(4,5)6/h8,13-18,20-21H,1,9-12H2,2-6H3 |
| InChIKey | VVHOWOFTEXHDIU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|