C12H8Cl2N2 — CID 88915351
2,9-dichloro-4,4a-dihydro-1,10-phenanthroline (PubChem CID 88915351) has the molecular formula C12H8Cl2N2 and a molecular weight of 251.12 g/mol. Its IUPAC name is 2,9-dichloro-4,4a-dihydro-1,10-phenanthroline.
| Compound Name | 2,9-dichloro-4,4a-dihydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 88915351 |
| Molecular Formula | C12H8Cl2N2 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2,9-dichloro-4,4a-dihydro-1,10-phenanthroline |
| SMILES | ClC1=CCC2C=Cc3ccc(Cl)nc3C2=N1 |
| InChI | InChI=1S/C12H8Cl2N2/c13-9-5-3-7-1-2-8-4-6-10(14)16-12(8)11(7)15-9/h1-3,5-6,8H,4H2 |
| InChIKey | OSBGRAXOXCPRCJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|