C8H8N2O4 — CID 88915358
3,6-diisocyanato-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 88915358) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 3,6-diisocyanato-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | 3,6-diisocyanato-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 88915358 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 3,6-diisocyanato-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | O=C=NC1COC2C(N=C=O)COC12 |
| InChI | InChI=1S/C8H8N2O4/c11-3-9-5-1-13-8-6(10-4-12)2-14-7(5)8/h5-8H,1-2H2 |
| InChIKey | UOFKIYLREZTZHF-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|