C36H38F5NO2 — CID 88915499
(11R,17S)-11-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 88915499) has the molecular formula C36H38F5NO2 and a molecular weight of 611.70 g/mol. Its IUPAC name is (11R,17S)-11-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,17S)-11-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88915499 |
| Molecular Formula | C36H38F5NO2 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.28 |
| IUPAC Name | (11R,17S)-11-[4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12C[C@H](c3ccc(CN4CCc5ccccc5C4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C36H38F5NO2/c1-33-19-30(24-8-6-22(7-9-24)20-42-17-15-23-4-2-3-5-26(23)21-42)32-28-13-11-27(43)18-25(28)10-12-29(32)31(33)14-16-34(33,44)35(37,38)36(39,40)41/h2-9,18,29-31,44H,10-17,19-21H2,1H3/t29?,30-,31?,33?,34+/m1/s1 |
| InChIKey | SMYQDCMFHGJKGD-MNEIVKSZSA-N |
| XLogP | 8.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|