C23H30O6S — CID 88915599
(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-8-(1-methylsulfanylethoxy)-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one (PubChem CID 88915599) has the molecular formula C23H30O6S and a molecular weight of 434.55 g/mol. Its IUPAC name is (1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-8-(1-methylsulfanylethoxy)-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one.
| Compound Name | (1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-8-(1-methylsulfanylethoxy)-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
|---|---|
| PubChem CID | 88915599 |
| Molecular Formula | C23H30O6S |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | (1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-8-(1-methylsulfanylethoxy)-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-17-one |
| SMILES | CSC(C)O[C@@H]1[C@@]2(C(C)C)O[C@H]2[C@@H]2O[C@]23[C@]12O[C@H]2C[C@H]1C2=C(CC[C@@]13C)C(=O)OC2 |
| InChI | InChI=1S/C23H30O6S/c1-10(2)21-16(28-21)17-23(29-17)20(4)7-6-12-13(9-25-18(12)24)14(20)8-15-22(23,27-15)19(21)26-11(3)30-5/h10-11,14-17,19H,6-9H2,1-5H3/t11?,14-,15-,16-,17-,19+,20-,21-,22+,23+/m0/s1 |
| InChIKey | VRVSDIKDYREYNG-IGMNVYERSA-N |
| XLogP | 2.84 |
| TPSA | 73.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|