C27H36O5S — CID 88916031
4-[[(1R,4aR,7S)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxysulfonyl]benzoic acid (PubChem CID 88916031) has the molecular formula C27H36O5S and a molecular weight of 472.65 g/mol. Its IUPAC name is 4-[[(1R,4aR,7S)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxysulfonyl]benzoic acid.
| Compound Name | 4-[[(1R,4aR,7S)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxysulfonyl]benzoic acid |
|---|---|
| PubChem CID | 88916031 |
| Molecular Formula | C27H36O5S |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 4-[[(1R,4aR,7S)-7-ethenyl-1,4a,7-trimethyl-3,4,6,8,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]methoxysulfonyl]benzoic acid |
| SMILES | C=C[C@@]1(C)CC=C2C(CCC3[C@](C)(COS(=O)(=O)c4ccc(C(=O)O)cc4)CCC[C@@]23C)C1 |
| InChI | InChI=1S/C27H36O5S/c1-5-25(2)16-13-22-20(17-25)9-12-23-26(3,14-6-15-27(22,23)4)18-32-33(30,31)21-10-7-19(8-11-21)24(28)29/h5,7-8,10-11,13,20,23H,1,6,9,12,14-18H2,2-4H3,(H,28,29)/t20?,23?,25-,26-,27-/m0/s1 |
| InChIKey | BGJOWJCNEXNMBH-MOTXCXSHSA-N |
| XLogP | 6.23 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|