About 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine
5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine (PubChem CID 88916468) has the molecular formula C9H20FNO
and a molecular weight of 177.26 g/mol. Its IUPAC name is 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine |
| PubChem CID | 88916468 |
| Molecular Formula | C9H20FNO |
| Molecular Weight | 177.26 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine |
| SMILES | CC(N)C(C)C(C)COCCF |
| InChI | InChI=1S/C9H20FNO/c1-7(6-12-5-4-10)8(2)9(3)11/h7-9H,4-6,11H2,1-3H3 |
| InChIKey | PODJYKPQMOYIGG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine?
The IUPAC name of 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine (CID 88916468) is 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine.
What is the SMILES notation for 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine?
The canonical SMILES for 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine is CC(N)C(C)C(C)COCCF.
What is the InChIKey of 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine?
The InChIKey is PODJYKPQMOYIGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20FNO/c1-7(6-12-5-4-10)8(2)9(3)11/h7-9H,4-6,11H2,1-3H3.
What are the key properties of 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine?
5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine has a molecular weight of 177.26 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoroethoxy)-3,4-dimethylpentan-2-amine is sourced from PubChem (CID 88916468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).