About 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde
4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde (PubChem CID 88916507) has the molecular formula C15H20N3OS+
and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde.
Molecular Properties
| Compound Name | 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde |
| PubChem CID | 88916507 |
| Molecular Formula | C15H20N3OS+ |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde |
| SMILES | CN(CCSc1n(C)cc[n+]1C)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C15H20N3OS/c1-16(14-6-4-13(12-19)5-7-14)10-11-20-15-17(2)8-9-18(15)3/h4-9,12H,10-11H2,1-3H3/q+1 |
| InChIKey | ROGMOYPOBMHCDG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde?
The IUPAC name of 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde (CID 88916507) is 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde.
What is the SMILES notation for 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde?
The canonical SMILES for 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde is CN(CCSc1n(C)cc[n+]1C)c1ccc(C=O)cc1.
What is the InChIKey of 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde?
The InChIKey is ROGMOYPOBMHCDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N3OS/c1-16(14-6-4-13(12-19)5-7-14)10-11-20-15-17(2)8-9-18(15)3/h4-9,12H,10-11H2,1-3H3/q+1.
What are the key properties of 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde?
4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde has a molecular weight of 290.41 g/mol, XLogP of 1.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-dimethylimidazol-1-ium-2-yl)sulfanylethyl-methylamino]benzaldehyde is sourced from PubChem (CID 88916507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).