C8H11F6NO2S — CID 88916710
1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)pyrrolidine (PubChem CID 88916710) has the molecular formula C8H11F6NO2S and a molecular weight of 299.24 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)pyrrolidine.
| Compound Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 88916710 |
| Molecular Formula | C8H11F6NO2S |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-(1,1,2,2,3,3-hexafluorobutylsulfonyl)pyrrolidine |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C8H11F6NO2S/c1-6(9,10)7(11,12)8(13,14)18(16,17)15-4-2-3-5-15/h2-5H2,1H3 |
| InChIKey | WBSHVACSSSMERJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|