C9H11F8NO2S — CID 88916714
1-(1,1,2,2,3,3,4,4-octafluoropentylsulfonyl)pyrrolidine (PubChem CID 88916714) has the molecular formula C9H11F8NO2S and a molecular weight of 349.24 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4-octafluoropentylsulfonyl)pyrrolidine.
| Compound Name | 1-(1,1,2,2,3,3,4,4-octafluoropentylsulfonyl)pyrrolidine |
|---|---|
| PubChem CID | 88916714 |
| Molecular Formula | C9H11F8NO2S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4-octafluoropentylsulfonyl)pyrrolidine |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C9H11F8NO2S/c1-6(10,11)7(12,13)8(14,15)9(16,17)21(19,20)18-4-2-3-5-18/h2-5H2,1H3 |
| InChIKey | HMYREIYLSQBCQA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|