C14H19F8NO2S — CID 88916717
1-(1,1,2,2,3,3,4,4-octafluoropentylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 88916717) has the molecular formula C14H19F8NO2S and a molecular weight of 417.36 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4-octafluoropentylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-(1,1,2,2,3,3,4,4-octafluoropentylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 88916717 |
| Molecular Formula | C14H19F8NO2S |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4-octafluoropentylsulfonyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C14H19F8NO2S/c1-11(15,16)12(17,18)13(19,20)14(21,22)26(24,25)23-8-4-6-9-5-2-3-7-10(9)23/h9-10H,2-8H2,1H3 |
| InChIKey | WRGXLJSLBLNIBB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|